C22H31ClN6O3 — CID 110175561
[3-[1,3-dimethyl-2,6-dioxo-8-(prop-2-enylamino)purin-7-yl]-2-hydroxypropyl]-(1-phenylpropan-2-yl)azanium chloride (PubChem CID 110175561) has the molecular formula C22H31ClN6O3 and a molecular weight of 462.98 g/mol. Its IUPAC name is [3-[1,3-dimethyl-2,6-dioxo-8-(prop-2-enylamino)purin-7-yl]-2-hydroxypropyl]-(1-phenylpropan-2-yl)azanium chloride.
| Compound Name | [3-[1,3-dimethyl-2,6-dioxo-8-(prop-2-enylamino)purin-7-yl]-2-hydroxypropyl]-(1-phenylpropan-2-yl)azanium chloride |
|---|---|
| PubChem CID | 110175561 |
| Molecular Formula | C22H31ClN6O3 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | [3-[1,3-dimethyl-2,6-dioxo-8-(prop-2-enylamino)purin-7-yl]-2-hydroxypropyl]-(1-phenylpropan-2-yl)azanium chloride |
| SMILES | C=CCNc1nc2c(c(=O)n(C)c(=O)n2C)n1CC(O)C[NH2+]C(C)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C22H30N6O3.ClH/c1-5-11-23-21-25-19-18(20(30)27(4)22(31)26(19)3)28(21)14-17(29)13-24-15(2)12-16-9-7-6-8-10-16;/h5-10,15,17,24,29H,1,11-14H2,2-4H3,(H,23,25);1H |
| InChIKey | DHTQYHHLOJYIOR-UHFFFAOYSA-N |
| XLogP | -3.41 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|