C17H25ClN2O4 — CID 110175328
[2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-[1-(2-methoxyphenyl)propan-2-yl]azanium chloride (PubChem CID 110175328) has the molecular formula C17H25ClN2O4 and a molecular weight of 356.85 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-[1-(2-methoxyphenyl)propan-2-yl]azanium chloride.
| Compound Name | [2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-[1-(2-methoxyphenyl)propan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 110175328 |
| Molecular Formula | C17H25ClN2O4 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-[1-(2-methoxyphenyl)propan-2-yl]azanium chloride |
| SMILES | COc1ccccc1CC(C)[NH2+]CC(O)C1CC(=O)NC(=O)C1.[Cl-] |
| InChI | InChI=1S/C17H24N2O4.ClH/c1-11(7-12-5-3-4-6-15(12)23-2)18-10-14(20)13-8-16(21)19-17(22)9-13;/h3-6,11,13-14,18,20H,7-10H2,1-2H3,(H,19,21,22);1H |
| InChIKey | IINVPTFPSDTNLU-UHFFFAOYSA-N |
| XLogP | -3.39 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|