About [2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-[1-(2-methoxyphenyl)propan-2-yl]azanium chloride
[2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-[1-(2-methoxyphenyl)propan-2-yl]azanium chloride (PubChem CID 110175328) has the molecular formula C17H25ClN2O4
and a molecular weight of 356.85 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-[1-(2-methoxyphenyl)propan-2-yl]azanium chloride.
Molecular Properties
| Compound Name | [2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-[1-(2-methoxyphenyl)propan-2-yl]azanium chloride |
| PubChem CID | 110175328 |
| Molecular Formula | C17H25ClN2O4 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-[1-(2-methoxyphenyl)propan-2-yl]azanium chloride |
| SMILES | COc1ccccc1CC(C)[NH2+]CC(O)C1CC(=O)NC(=O)C1.[Cl-] |
| InChI | InChI=1S/C17H24N2O4.ClH/c1-11(7-12-5-3-4-6-15(12)23-2)18-10-14(20)13-8-16(21)19-17(22)9-13;/h3-6,11,13-14,18,20H,7-10H2,1-2H3,(H,19,21,22);1H |
| InChIKey | IINVPTFPSDTNLU-UHFFFAOYSA-N |
| XLogP | -3.39 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-[1-(2-methoxyphenyl)propan-2-yl]azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-[1-(2-methoxyphenyl)propan-2-yl]azanium chloride?
The IUPAC name of [2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-[1-(2-methoxyphenyl)propan-2-yl]azanium chloride (CID 110175328) is [2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-[1-(2-methoxyphenyl)propan-2-yl]azanium chloride.
What is the SMILES notation for [2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-[1-(2-methoxyphenyl)propan-2-yl]azanium chloride?
The canonical SMILES for [2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-[1-(2-methoxyphenyl)propan-2-yl]azanium chloride is COc1ccccc1CC(C)[NH2+]CC(O)C1CC(=O)NC(=O)C1.[Cl-].
What is the InChIKey of [2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-[1-(2-methoxyphenyl)propan-2-yl]azanium chloride?
The InChIKey is IINVPTFPSDTNLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O4.ClH/c1-11(7-12-5-3-4-6-15(12)23-2)18-10-14(20)13-8-16(21)19-17(22)9-13;/h3-6,11,13-14,18,20H,7-10H2,1-2H3,(H,19,21,22);1H.
What are the key properties of [2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-[1-(2-methoxyphenyl)propan-2-yl]azanium chloride?
[2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-[1-(2-methoxyphenyl)propan-2-yl]azanium chloride has a molecular weight of 356.85 g/mol, XLogP of -3.39, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,6-dioxopiperidin-4-yl)-2-hydroxyethyl]-[1-(2-methoxyphenyl)propan-2-yl]azanium chloride is sourced from PubChem (CID 110175328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).