C20H21Cl2NO2 — CID 110175929
(E)-1-(3,4-dichlorophenyl)-5-[(1-hydroxy-1-phenylpropan-2-yl)amino]pent-1-en-3-one (PubChem CID 110175929) has the molecular formula C20H21Cl2NO2 and a molecular weight of 378.30 g/mol. Its IUPAC name is (E)-1-(3,4-dichlorophenyl)-5-[(1-hydroxy-1-phenylpropan-2-yl)amino]pent-1-en-3-one.
| Compound Name | (E)-1-(3,4-dichlorophenyl)-5-[(1-hydroxy-1-phenylpropan-2-yl)amino]pent-1-en-3-one |
|---|---|
| PubChem CID | 110175929 |
| Molecular Formula | C20H21Cl2NO2 |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (E)-1-(3,4-dichlorophenyl)-5-[(1-hydroxy-1-phenylpropan-2-yl)amino]pent-1-en-3-one |
| SMILES | CC(NCCC(=O)/C=C/c1ccc(Cl)c(Cl)c1)C(O)c1ccccc1 |
| InChI | InChI=1S/C20H21Cl2NO2/c1-14(20(25)16-5-3-2-4-6-16)23-12-11-17(24)9-7-15-8-10-18(21)19(22)13-15/h2-10,13-14,20,23,25H,11-12H2,1H3/b9-7+ |
| InChIKey | SFXGIMCPVKEWLT-VQHVLOKHSA-N |
| XLogP | 4.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|