C23H31NO2 — CID 110176514
(E)-5-[(1-hydroxy-1-phenylpropan-2-yl)amino]-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)pent-1-en-3-one (PubChem CID 110176514) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (E)-5-[(1-hydroxy-1-phenylpropan-2-yl)amino]-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)pent-1-en-3-one.
| Compound Name | (E)-5-[(1-hydroxy-1-phenylpropan-2-yl)amino]-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)pent-1-en-3-one |
|---|---|
| PubChem CID | 110176514 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | (E)-5-[(1-hydroxy-1-phenylpropan-2-yl)amino]-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)pent-1-en-3-one |
| SMILES | CC1=C(/C=C/C(=O)CCNC(C)C(O)c2ccccc2)C(C)(C)CC=C1 |
| InChI | InChI=1S/C23H31NO2/c1-17-9-8-15-23(3,4)21(17)13-12-20(25)14-16-24-18(2)22(26)19-10-6-5-7-11-19/h5-13,18,22,24,26H,14-16H2,1-4H3/b13-12+ |
| InChIKey | CSPGAJWSYOCJIC-OUKQBFOZSA-N |
| XLogP | 4.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|