C22H23NO4 — CID 110174890
3-[3-[(1-hydroxy-1-phenylpropan-2-yl)amino]propanoyl]-2-methylchromen-4-one (PubChem CID 110174890) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 3-[3-[(1-hydroxy-1-phenylpropan-2-yl)amino]propanoyl]-2-methylchromen-4-one.
| Compound Name | 3-[3-[(1-hydroxy-1-phenylpropan-2-yl)amino]propanoyl]-2-methylchromen-4-one |
|---|---|
| PubChem CID | 110174890 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 3-[3-[(1-hydroxy-1-phenylpropan-2-yl)amino]propanoyl]-2-methylchromen-4-one |
| SMILES | Cc1oc2ccccc2c(=O)c1C(=O)CCNC(C)C(O)c1ccccc1 |
| InChI | InChI=1S/C22H23NO4/c1-14(21(25)16-8-4-3-5-9-16)23-13-12-18(24)20-15(2)27-19-11-7-6-10-17(19)22(20)26/h3-11,14,21,23,25H,12-13H2,1-2H3 |
| InChIKey | QGDNGDWLOAHVEW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |