C19H27NO2 — CID 110182601
3-[(1-hydroxy-1-phenylpropan-2-yl)amino]-1-(2-methylcyclohexen-1-yl)propan-1-one (PubChem CID 110182601) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 3-[(1-hydroxy-1-phenylpropan-2-yl)amino]-1-(2-methylcyclohexen-1-yl)propan-1-one.
| Compound Name | 3-[(1-hydroxy-1-phenylpropan-2-yl)amino]-1-(2-methylcyclohexen-1-yl)propan-1-one |
|---|---|
| PubChem CID | 110182601 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 3-[(1-hydroxy-1-phenylpropan-2-yl)amino]-1-(2-methylcyclohexen-1-yl)propan-1-one |
| SMILES | CC1=C(C(=O)CCNC(C)C(O)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C19H27NO2/c1-14-8-6-7-11-17(14)18(21)12-13-20-15(2)19(22)16-9-4-3-5-10-16/h3-5,9-10,15,19-20,22H,6-8,11-13H2,1-2H3 |
| InChIKey | ODGOPYLQQOYTCV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |