C21H22ClNO2S — CID 110176233
3-[[2-(4-chlorophenyl)-2-hydroxyethyl]amino]-1-phenyl-1-thiophen-2-ylpropan-1-ol (PubChem CID 110176233) has the molecular formula C21H22ClNO2S and a molecular weight of 387.93 g/mol. Its IUPAC name is 3-[[2-(4-chlorophenyl)-2-hydroxyethyl]amino]-1-phenyl-1-thiophen-2-ylpropan-1-ol.
| Compound Name | 3-[[2-(4-chlorophenyl)-2-hydroxyethyl]amino]-1-phenyl-1-thiophen-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 110176233 |
| Molecular Formula | C21H22ClNO2S |
| Molecular Weight | 387.93 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 3-[[2-(4-chlorophenyl)-2-hydroxyethyl]amino]-1-phenyl-1-thiophen-2-ylpropan-1-ol |
| SMILES | OC(CNCCC(O)(c1ccccc1)c1cccs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClNO2S/c22-18-10-8-16(9-11-18)19(24)15-23-13-12-21(25,20-7-4-14-26-20)17-5-2-1-3-6-17/h1-11,14,19,23-25H,12-13,15H2 |
| InChIKey | ZOHNERUPRDBYAV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.93 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|