C19H22ClNO2 — CID 110176847
1-(4-chloro-3-methylphenyl)-3-[(2-methoxy-2-phenylethyl)amino]propan-1-one (PubChem CID 110176847) has the molecular formula C19H22ClNO2 and a molecular weight of 331.84 g/mol. Its IUPAC name is 1-(4-chloro-3-methylphenyl)-3-[(2-methoxy-2-phenylethyl)amino]propan-1-one.
| Compound Name | 1-(4-chloro-3-methylphenyl)-3-[(2-methoxy-2-phenylethyl)amino]propan-1-one |
|---|---|
| PubChem CID | 110176847 |
| Molecular Formula | C19H22ClNO2 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 1-(4-chloro-3-methylphenyl)-3-[(2-methoxy-2-phenylethyl)amino]propan-1-one |
| SMILES | COC(CNCCC(=O)c1ccc(Cl)c(C)c1)c1ccccc1 |
| InChI | InChI=1S/C19H22ClNO2/c1-14-12-16(8-9-17(14)20)18(22)10-11-21-13-19(23-2)15-6-4-3-5-7-15/h3-9,12,19,21H,10-11,13H2,1-2H3 |
| InChIKey | OPQYCBDQHZKAQO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|