C20H24ClNO3 — CID 110177622
3-[[3-(4-chlorophenoxy)-2-hydroxypropyl]amino]-1-(3,4-dimethylphenyl)propan-1-one (PubChem CID 110177622) has the molecular formula C20H24ClNO3 and a molecular weight of 361.87 g/mol. Its IUPAC name is 3-[[3-(4-chlorophenoxy)-2-hydroxypropyl]amino]-1-(3,4-dimethylphenyl)propan-1-one.
| Compound Name | 3-[[3-(4-chlorophenoxy)-2-hydroxypropyl]amino]-1-(3,4-dimethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 110177622 |
| Molecular Formula | C20H24ClNO3 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 3-[[3-(4-chlorophenoxy)-2-hydroxypropyl]amino]-1-(3,4-dimethylphenyl)propan-1-one |
| SMILES | Cc1ccc(C(=O)CCNCC(O)COc2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C20H24ClNO3/c1-14-3-4-16(11-15(14)2)20(24)9-10-22-12-18(23)13-25-19-7-5-17(21)6-8-19/h3-8,11,18,22-23H,9-10,12-13H2,1-2H3 |
| InChIKey | DDKXMHAOXPEGQM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|