C27H41NO2 — CID 110177881
2-[[3-hydroxy-3-(4-nonylphenyl)propyl]amino]-1-phenylpropan-1-ol (PubChem CID 110177881) has the molecular formula C27H41NO2 and a molecular weight of 411.63 g/mol. Its IUPAC name is 2-[[3-hydroxy-3-(4-nonylphenyl)propyl]amino]-1-phenylpropan-1-ol.
| Compound Name | 2-[[3-hydroxy-3-(4-nonylphenyl)propyl]amino]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 110177881 |
| Molecular Formula | C27H41NO2 |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.31 |
| IUPAC Name | 2-[[3-hydroxy-3-(4-nonylphenyl)propyl]amino]-1-phenylpropan-1-ol |
| SMILES | CCCCCCCCCc1ccc(C(O)CCNC(C)C(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H41NO2/c1-3-4-5-6-7-8-10-13-23-16-18-24(19-17-23)26(29)20-21-28-22(2)27(30)25-14-11-9-12-15-25/h9,11-12,14-19,22,26-30H,3-8,10,13,20-21H2,1-2H3 |
| InChIKey | YEDWFNZHCNESNW-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|