C42H62N2O2S2 — CID 158106659
1-(3,4-dihydro-2H-thiochromen-6-yl)-2-(octylamino)propan-1-ol;1-(3,4-dihydro-2H-thiochromen-6-yl)-2-(4-phenylbutylamino)propan-1-ol (PubChem CID 158106659) has the molecular formula C42H62N2O2S2 and a molecular weight of 691.10 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-thiochromen-6-yl)-2-(octylamino)propan-1-ol;1-(3,4-dihydro-2H-thiochromen-6-yl)-2-(4-phenylbutylamino)propan-1-ol.
| Compound Name | 1-(3,4-dihydro-2H-thiochromen-6-yl)-2-(octylamino)propan-1-ol;1-(3,4-dihydro-2H-thiochromen-6-yl)-2-(4-phenylbutylamino)propan-1-ol |
|---|---|
| PubChem CID | 158106659 |
| Molecular Formula | C42H62N2O2S2 |
| Molecular Weight | 691.10 g/mol |
| Exact Mass | 690.43 |
| IUPAC Name | 1-(3,4-dihydro-2H-thiochromen-6-yl)-2-(octylamino)propan-1-ol;1-(3,4-dihydro-2H-thiochromen-6-yl)-2-(4-phenylbutylamino)propan-1-ol |
| SMILES | CC(NCCCCc1ccccc1)C(O)c1ccc2c(c1)CCCS2.CCCCCCCCNC(C)C(O)c1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C22H29NOS.C20H33NOS/c1-17(23-14-6-5-10-18-8-3-2-4-9-18)22(24)20-12-13-21-19(16-20)11-7-15-25-21;1-3-4-5-6-7-8-13-21-16(2)20(22)18-11-12-19-17(15-18)10-9-14-23-19/h2-4,8-9,12-13,16-17,22-24H,5-7,10-11,14-15H2,1H3;11-12,15-16,20-22H,3-10,13-14H2,1-2H3 |
| InChIKey | FPXONPRONIQMGA-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.10 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|