C19H32ClNOS — CID 3048817
2-(3-butylsulfanylpropylamino)-1-(2,3-dihydro-1H-inden-5-yl)propan-1-ol;hydrochloride (PubChem CID 3048817) has the molecular formula C19H32ClNOS and a molecular weight of 357.99 g/mol. Its IUPAC name is 2-(3-butylsulfanylpropylamino)-1-(2,3-dihydro-1H-inden-5-yl)propan-1-ol;hydrochloride.
| Compound Name | 2-(3-butylsulfanylpropylamino)-1-(2,3-dihydro-1H-inden-5-yl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 3048817 |
| Molecular Formula | C19H32ClNOS |
| Molecular Weight | 357.99 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 2-(3-butylsulfanylpropylamino)-1-(2,3-dihydro-1H-inden-5-yl)propan-1-ol;hydrochloride |
| SMILES | CCCCSCCCNC(C)C(O)c1ccc2c(c1)CCC2.Cl |
| InChI | InChI=1S/C19H31NOS.ClH/c1-3-4-12-22-13-6-11-20-15(2)19(21)18-10-9-16-7-5-8-17(16)14-18;/h9-10,14-15,19-21H,3-8,11-13H2,1-2H3;1H |
| InChIKey | CYWGBWYMBJQSDJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.99 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|