C16H26FNO — CID 82315039
1-(4-fluoro-3-methylphenyl)-2-(hexylamino)propan-1-ol (PubChem CID 82315039) has the molecular formula C16H26FNO and a molecular weight of 267.39 g/mol. Its IUPAC name is 1-(4-fluoro-3-methylphenyl)-2-(hexylamino)propan-1-ol.
| Compound Name | 1-(4-fluoro-3-methylphenyl)-2-(hexylamino)propan-1-ol |
|---|---|
| PubChem CID | 82315039 |
| Molecular Formula | C16H26FNO |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 1-(4-fluoro-3-methylphenyl)-2-(hexylamino)propan-1-ol |
| SMILES | CCCCCCNC(C)C(O)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C16H26FNO/c1-4-5-6-7-10-18-13(3)16(19)14-8-9-15(17)12(2)11-14/h8-9,11,13,16,18-19H,4-7,10H2,1-3H3 |
| InChIKey | LQVOJBTZOMORQO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|