C14H21ClN2O — CID 110179232
(4-acetamidophenyl)-cyclohexylazanium chloride (PubChem CID 110179232) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is (4-acetamidophenyl)-cyclohexylazanium chloride.
| Compound Name | (4-acetamidophenyl)-cyclohexylazanium chloride |
|---|---|
| PubChem CID | 110179232 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (4-acetamidophenyl)-cyclohexylazanium chloride |
| SMILES | CC(=O)Nc1ccc([NH2+]C2CCCCC2)cc1.[Cl-] |
| InChI | InChI=1S/C14H20N2O.ClH/c1-11(17)15-13-7-9-14(10-8-13)16-12-5-3-2-4-6-12;/h7-10,12,16H,2-6H2,1H3,(H,15,17);1H |
| InChIKey | QRTLBCPVLXOQQT-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|