C19H27N5O2 — CID 110179243
1-(6-anilino-3-pyridinyl)-3-[3-(diethylamino)-2-hydroxypropyl]urea (PubChem CID 110179243) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 1-(6-anilino-3-pyridinyl)-3-[3-(diethylamino)-2-hydroxypropyl]urea.
| Compound Name | 1-(6-anilino-3-pyridinyl)-3-[3-(diethylamino)-2-hydroxypropyl]urea |
|---|---|
| PubChem CID | 110179243 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 1-(6-anilino-3-pyridinyl)-3-[3-(diethylamino)-2-hydroxypropyl]urea |
| SMILES | CCN(CC)CC(O)CNC(=O)Nc1ccc(Nc2ccccc2)nc1 |
| InChI | InChI=1S/C19H27N5O2/c1-3-24(4-2)14-17(25)13-21-19(26)23-16-10-11-18(20-12-16)22-15-8-6-5-7-9-15/h5-12,17,25H,3-4,13-14H2,1-2H3,(H,20,22)(H2,21,23,26) |
| InChIKey | AEALSVQXVWRKDY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |