C28H40O7 — CID 110180815
3-(1-ethoxyethoxy)-5,14-dihydroxy-13-methyl-17-(6-oxopyran-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde (PubChem CID 110180815) has the molecular formula C28H40O7 and a molecular weight of 488.62 g/mol. Its IUPAC name is 3-(1-ethoxyethoxy)-5,14-dihydroxy-13-methyl-17-(6-oxopyran-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde.
| Compound Name | 3-(1-ethoxyethoxy)-5,14-dihydroxy-13-methyl-17-(6-oxopyran-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
|---|---|
| PubChem CID | 110180815 |
| Molecular Formula | C28H40O7 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 3-(1-ethoxyethoxy)-5,14-dihydroxy-13-methyl-17-(6-oxopyran-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
| SMILES | CCOC(C)OC1CCC2(C=O)C3CCC4(C)C(c5ccc(=O)oc5)CCC4(O)C3CCC2(O)C1 |
| InChI | InChI=1S/C28H40O7/c1-4-33-18(2)35-20-7-12-26(17-29)22-8-11-25(3)21(19-5-6-24(30)34-16-19)10-14-28(25,32)23(22)9-13-27(26,31)15-20/h5-6,16-18,20-23,31-32H,4,7-15H2,1-3H3 |
| InChIKey | LWJYZPWRXGAYPW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|