C27H35ClO7 — CID 13200452
[10-formyl-5,14-dihydroxy-13-methyl-17-(6-oxopyran-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-chloropropanoate (PubChem CID 13200452) has the molecular formula C27H35ClO7 and a molecular weight of 507.02 g/mol. Its IUPAC name is [10-formyl-5,14-dihydroxy-13-methyl-17-(6-oxopyran-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-chloropropanoate.
| Compound Name | [10-formyl-5,14-dihydroxy-13-methyl-17-(6-oxopyran-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-chloropropanoate |
|---|---|
| PubChem CID | 13200452 |
| Molecular Formula | C27H35ClO7 |
| Molecular Weight | 507.02 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | [10-formyl-5,14-dihydroxy-13-methyl-17-(6-oxopyran-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-chloropropanoate |
| SMILES | CC12CCC3C(CCC4(O)CC(OC(=O)CCCl)CCC34C=O)C1(O)CCC2c1ccc(=O)oc1 |
| InChI | InChI=1S/C27H35ClO7/c1-24-9-5-20-21(27(24,33)12-7-19(24)17-2-3-22(30)34-15-17)6-11-26(32)14-18(35-23(31)8-13-28)4-10-25(20,26)16-29/h2-3,15-16,18-21,32-33H,4-14H2,1H3 |
| InChIKey | HCYWAFJJVHVCLB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.02 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|