C27H31FN2O2 — CID 110181954
1-[1,3-bis(4-methylphenoxy)propan-2-yl]-4-(4-fluorophenyl)piperazine (PubChem CID 110181954) has the molecular formula C27H31FN2O2 and a molecular weight of 434.56 g/mol. Its IUPAC name is 1-[1,3-bis(4-methylphenoxy)propan-2-yl]-4-(4-fluorophenyl)piperazine.
| Compound Name | 1-[1,3-bis(4-methylphenoxy)propan-2-yl]-4-(4-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 110181954 |
| Molecular Formula | C27H31FN2O2 |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 1-[1,3-bis(4-methylphenoxy)propan-2-yl]-4-(4-fluorophenyl)piperazine |
| SMILES | Cc1ccc(OCC(COc2ccc(C)cc2)N2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H31FN2O2/c1-21-3-11-26(12-4-21)31-19-25(20-32-27-13-5-22(2)6-14-27)30-17-15-29(16-18-30)24-9-7-23(28)8-10-24/h3-14,25H,15-20H2,1-2H3 |
| InChIKey | XONVIWPOGGQPHN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |