C27H32N2O2 — CID 110181956
1-[1,3-bis(4-methylphenoxy)propan-2-yl]-4-phenylpiperazine (PubChem CID 110181956) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 1-[1,3-bis(4-methylphenoxy)propan-2-yl]-4-phenylpiperazine.
| Compound Name | 1-[1,3-bis(4-methylphenoxy)propan-2-yl]-4-phenylpiperazine |
|---|---|
| PubChem CID | 110181956 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 1-[1,3-bis(4-methylphenoxy)propan-2-yl]-4-phenylpiperazine |
| SMILES | Cc1ccc(OCC(COc2ccc(C)cc2)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H32N2O2/c1-22-8-12-26(13-9-22)30-20-25(21-31-27-14-10-23(2)11-15-27)29-18-16-28(17-19-29)24-6-4-3-5-7-24/h3-15,25H,16-21H2,1-2H3 |
| InChIKey | VZZCNOBUCJISDB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |