C20H29NO — CID 110185675
1-[2-[cyclopentylidene-(2-methylphenyl)methoxy]ethyl]piperidine (PubChem CID 110185675) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is 1-[2-[cyclopentylidene-(2-methylphenyl)methoxy]ethyl]piperidine.
| Compound Name | 1-[2-[cyclopentylidene-(2-methylphenyl)methoxy]ethyl]piperidine |
|---|---|
| PubChem CID | 110185675 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 1-[2-[cyclopentylidene-(2-methylphenyl)methoxy]ethyl]piperidine |
| SMILES | Cc1ccccc1C(OCCN1CCCCC1)=C1CCCC1 |
| InChI | InChI=1S/C20H29NO/c1-17-9-3-6-12-19(17)20(18-10-4-5-11-18)22-16-15-21-13-7-2-8-14-21/h3,6,9,12H,2,4-5,7-8,10-11,13-16H2,1H3 |
| InChIKey | QOEJLSHJXNVVBX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|