C21H34N2O2 — CID 110185924
3-methylbutyl 3-phenyl-2-(2-piperidin-1-ylethylamino)propanoate (PubChem CID 110185924) has the molecular formula C21H34N2O2 and a molecular weight of 346.51 g/mol. Its IUPAC name is 3-methylbutyl 3-phenyl-2-(2-piperidin-1-ylethylamino)propanoate.
| Compound Name | 3-methylbutyl 3-phenyl-2-(2-piperidin-1-ylethylamino)propanoate |
|---|---|
| PubChem CID | 110185924 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | 3-methylbutyl 3-phenyl-2-(2-piperidin-1-ylethylamino)propanoate |
| SMILES | CC(C)CCOC(=O)C(Cc1ccccc1)NCCN1CCCCC1 |
| InChI | InChI=1S/C21H34N2O2/c1-18(2)11-16-25-21(24)20(17-19-9-5-3-6-10-19)22-12-15-23-13-7-4-8-14-23/h3,5-6,9-10,18,20,22H,4,7-8,11-17H2,1-2H3 |
| InChIKey | YCUHCYOAMAWYGB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |