C10H10ClN3O2 — CID 110187680
3-(3-chloro-4-methoxyphenyl)-2,5-dihydro-1H-1,2,4-triazin-6-one (PubChem CID 110187680) has the molecular formula C10H10ClN3O2 and a molecular weight of 239.66 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyphenyl)-2,5-dihydro-1H-1,2,4-triazin-6-one.
| Compound Name | 3-(3-chloro-4-methoxyphenyl)-2,5-dihydro-1H-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 110187680 |
| Molecular Formula | C10H10ClN3O2 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 3-(3-chloro-4-methoxyphenyl)-2,5-dihydro-1H-1,2,4-triazin-6-one |
| SMILES | COc1ccc(C2=NCC(=O)NN2)cc1Cl |
| InChI | InChI=1S/C10H10ClN3O2/c1-16-8-3-2-6(4-7(8)11)10-12-5-9(15)13-14-10/h2-4H,5H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | KIBMOBIGNIDSBJ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |