C11H8ClIN2O3 — CID 66312316
2-(3-chloro-4-methoxyphenyl)-4-hydroxy-5-iodo-1H-pyrimidin-6-one (PubChem CID 66312316) has the molecular formula C11H8ClIN2O3 and a molecular weight of 378.55 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyphenyl)-4-hydroxy-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 2-(3-chloro-4-methoxyphenyl)-4-hydroxy-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 66312316 |
| Molecular Formula | C11H8ClIN2O3 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | 2-(3-chloro-4-methoxyphenyl)-4-hydroxy-5-iodo-1H-pyrimidin-6-one |
| SMILES | COc1ccc(-c2nc(O)c(I)c(=O)[nH]2)cc1Cl |
| InChI | InChI=1S/C11H8ClIN2O3/c1-18-7-3-2-5(4-6(7)12)9-14-10(16)8(13)11(17)15-9/h2-4H,1H3,(H2,14,15,16,17) |
| InChIKey | XEBJATAGBWJTNQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|