C12H11IN2O3 — CID 66313095
4-hydroxy-5-iodo-2-(4-methoxy-3-methylphenyl)-1H-pyrimidin-6-one (PubChem CID 66313095) has the molecular formula C12H11IN2O3 and a molecular weight of 358.14 g/mol. Its IUPAC name is 4-hydroxy-5-iodo-2-(4-methoxy-3-methylphenyl)-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-5-iodo-2-(4-methoxy-3-methylphenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 66313095 |
| Molecular Formula | C12H11IN2O3 |
| Molecular Weight | 358.14 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 4-hydroxy-5-iodo-2-(4-methoxy-3-methylphenyl)-1H-pyrimidin-6-one |
| SMILES | COc1ccc(-c2nc(O)c(I)c(=O)[nH]2)cc1C |
| InChI | InChI=1S/C12H11IN2O3/c1-6-5-7(3-4-8(6)18-2)10-14-11(16)9(13)12(17)15-10/h3-5H,1-2H3,(H2,14,15,16,17) |
| InChIKey | UKVVXVOLDKCTAY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.14 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|