C16H14Cl2N3O2+ — CID 110187926
5-[1-[(2,6-dichlorophenyl)methyl]pyridin-1-ium-3-yl]-5-methylimidazolidine-2,4-dione (PubChem CID 110187926) has the molecular formula C16H14Cl2N3O2+ and a molecular weight of 351.21 g/mol. Its IUPAC name is 5-[1-[(2,6-dichlorophenyl)methyl]pyridin-1-ium-3-yl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[1-[(2,6-dichlorophenyl)methyl]pyridin-1-ium-3-yl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 110187926 |
| Molecular Formula | C16H14Cl2N3O2+ |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 5-[1-[(2,6-dichlorophenyl)methyl]pyridin-1-ium-3-yl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc[n+](Cc3c(Cl)cccc3Cl)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C16H13Cl2N3O2/c1-16(14(22)19-15(23)20-16)10-4-3-7-21(8-10)9-11-12(17)5-2-6-13(11)18/h2-8H,9H2,1H3,(H-,19,20,22,23)/p+1 |
| InChIKey | WCUUQVSNECJLCE-UHFFFAOYSA-O |
| XLogP | 2.38 |
| TPSA | 62.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|