About methyl 4-[(4-pyridin-1-ium-3-yloxyphenyl)carbamoyloxy]benzoate chloride
methyl 4-[(4-pyridin-1-ium-3-yloxyphenyl)carbamoyloxy]benzoate chloride (PubChem CID 110188422) has the molecular formula C20H17ClN2O5
and a molecular weight of 400.82 g/mol. Its IUPAC name is methyl 4-[(4-pyridin-1-ium-3-yloxyphenyl)carbamoyloxy]benzoate chloride.
Molecular Properties
| Compound Name | methyl 4-[(4-pyridin-1-ium-3-yloxyphenyl)carbamoyloxy]benzoate chloride |
| PubChem CID | 110188422 |
| Molecular Formula | C20H17ClN2O5 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | methyl 4-[(4-pyridin-1-ium-3-yloxyphenyl)carbamoyloxy]benzoate chloride |
| SMILES | COC(=O)c1ccc(OC(=O)Nc2ccc(Oc3ccc[nH+]c3)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C20H16N2O5.ClH/c1-25-19(23)14-4-8-17(9-5-14)27-20(24)22-15-6-10-16(11-7-15)26-18-3-2-12-21-13-18;/h2-13H,1H3,(H,22,24);1H |
| InChIKey | HYEVENYGWXCWCS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[(4-pyridin-1-ium-3-yloxyphenyl)carbamoyloxy]benzoate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(4-pyridin-1-ium-3-yloxyphenyl)carbamoyloxy]benzoate chloride?
The IUPAC name of methyl 4-[(4-pyridin-1-ium-3-yloxyphenyl)carbamoyloxy]benzoate chloride (CID 110188422) is methyl 4-[(4-pyridin-1-ium-3-yloxyphenyl)carbamoyloxy]benzoate chloride.
What is the SMILES notation for methyl 4-[(4-pyridin-1-ium-3-yloxyphenyl)carbamoyloxy]benzoate chloride?
The canonical SMILES for methyl 4-[(4-pyridin-1-ium-3-yloxyphenyl)carbamoyloxy]benzoate chloride is COC(=O)c1ccc(OC(=O)Nc2ccc(Oc3ccc[nH+]c3)cc2)cc1.[Cl-].
What is the InChIKey of methyl 4-[(4-pyridin-1-ium-3-yloxyphenyl)carbamoyloxy]benzoate chloride?
The InChIKey is HYEVENYGWXCWCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O5.ClH/c1-25-19(23)14-4-8-17(9-5-14)27-20(24)22-15-6-10-16(11-7-15)26-18-3-2-12-21-13-18;/h2-13H,1H3,(H,22,24);1H.
What are the key properties of methyl 4-[(4-pyridin-1-ium-3-yloxyphenyl)carbamoyloxy]benzoate chloride?
methyl 4-[(4-pyridin-1-ium-3-yloxyphenyl)carbamoyloxy]benzoate chloride has a molecular weight of 400.82 g/mol, XLogP of 0.69, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(4-pyridin-1-ium-3-yloxyphenyl)carbamoyloxy]benzoate chloride is sourced from PubChem (CID 110188422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).