About phenyl N-[4-(6-methylpyridin-1-ium-3-yl)oxyphenyl]carbamate chloride
phenyl N-[4-(6-methylpyridin-1-ium-3-yl)oxyphenyl]carbamate chloride (PubChem CID 110188496) has the molecular formula C19H17ClN2O3
and a molecular weight of 356.81 g/mol. Its IUPAC name is phenyl N-[4-(6-methylpyridin-1-ium-3-yl)oxyphenyl]carbamate chloride.
Molecular Properties
| Compound Name | phenyl N-[4-(6-methylpyridin-1-ium-3-yl)oxyphenyl]carbamate chloride |
| PubChem CID | 110188496 |
| Molecular Formula | C19H17ClN2O3 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | phenyl N-[4-(6-methylpyridin-1-ium-3-yl)oxyphenyl]carbamate chloride |
| SMILES | Cc1ccc(Oc2ccc(NC(=O)Oc3ccccc3)cc2)c[nH+]1.[Cl-] |
| InChI | InChI=1S/C19H16N2O3.ClH/c1-14-7-10-18(13-20-14)23-17-11-8-15(9-12-17)21-19(22)24-16-5-3-2-4-6-16;/h2-13H,1H3,(H,21,22);1H |
| InChIKey | BGCSIAKELKKRID-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenyl N-[4-(6-methylpyridin-1-ium-3-yl)oxyphenyl]carbamate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-[4-(6-methylpyridin-1-ium-3-yl)oxyphenyl]carbamate chloride?
The IUPAC name of phenyl N-[4-(6-methylpyridin-1-ium-3-yl)oxyphenyl]carbamate chloride (CID 110188496) is phenyl N-[4-(6-methylpyridin-1-ium-3-yl)oxyphenyl]carbamate chloride.
What is the SMILES notation for phenyl N-[4-(6-methylpyridin-1-ium-3-yl)oxyphenyl]carbamate chloride?
The canonical SMILES for phenyl N-[4-(6-methylpyridin-1-ium-3-yl)oxyphenyl]carbamate chloride is Cc1ccc(Oc2ccc(NC(=O)Oc3ccccc3)cc2)c[nH+]1.[Cl-].
What is the InChIKey of phenyl N-[4-(6-methylpyridin-1-ium-3-yl)oxyphenyl]carbamate chloride?
The InChIKey is BGCSIAKELKKRID-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O3.ClH/c1-14-7-10-18(13-20-14)23-17-11-8-15(9-12-17)21-19(22)24-16-5-3-2-4-6-16;/h2-13H,1H3,(H,21,22);1H.
What are the key properties of phenyl N-[4-(6-methylpyridin-1-ium-3-yl)oxyphenyl]carbamate chloride?
phenyl N-[4-(6-methylpyridin-1-ium-3-yl)oxyphenyl]carbamate chloride has a molecular weight of 356.81 g/mol, XLogP of 1.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-[4-(6-methylpyridin-1-ium-3-yl)oxyphenyl]carbamate chloride is sourced from PubChem (CID 110188496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).