C16H22ClN3O — CID 110188609
2-piperidin-1-ium-4-yl-4-propylphthalazin-1-one chloride (PubChem CID 110188609) has the molecular formula C16H22ClN3O and a molecular weight of 307.82 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-yl-4-propylphthalazin-1-one chloride.
| Compound Name | 2-piperidin-1-ium-4-yl-4-propylphthalazin-1-one chloride |
|---|---|
| PubChem CID | 110188609 |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-piperidin-1-ium-4-yl-4-propylphthalazin-1-one chloride |
| SMILES | CCCc1nn(C2CC[NH2+]CC2)c(=O)c2ccccc12.[Cl-] |
| InChI | InChI=1S/C16H21N3O.ClH/c1-2-5-15-13-6-3-4-7-14(13)16(20)19(18-15)12-8-10-17-11-9-12;/h3-4,6-7,12,17H,2,5,8-11H2,1H3;1H |
| InChIKey | PPKNRCVPMTYBTI-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 51.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |