C23H24ClN3O — CID 110186118
4-[(4-chlorophenyl)methyl]-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)phthalazin-1-one (PubChem CID 110186118) has the molecular formula C23H24ClN3O and a molecular weight of 393.92 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)phthalazin-1-one.
| Compound Name | 4-[(4-chlorophenyl)methyl]-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)phthalazin-1-one |
|---|---|
| PubChem CID | 110186118 |
| Molecular Formula | C23H24ClN3O |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)phthalazin-1-one |
| SMILES | CN1C2CCC1CC(n1nc(Cc3ccc(Cl)cc3)c3ccccc3c1=O)C2 |
| InChI | InChI=1S/C23H24ClN3O/c1-26-17-10-11-18(26)14-19(13-17)27-23(28)21-5-3-2-4-20(21)22(25-27)12-15-6-8-16(24)9-7-15/h2-9,17-19H,10-14H2,1H3 |
| InChIKey | FSLFSOIDVDUHEK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |