C29H29ClFN3O — CID 3066461
4-[(4-chlorophenyl)methyl]-2-[1-[2-(4-fluorophenyl)ethyl]azepan-4-yl]phthalazin-1-one (PubChem CID 3066461) has the molecular formula C29H29ClFN3O and a molecular weight of 490.02 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-2-[1-[2-(4-fluorophenyl)ethyl]azepan-4-yl]phthalazin-1-one.
| Compound Name | 4-[(4-chlorophenyl)methyl]-2-[1-[2-(4-fluorophenyl)ethyl]azepan-4-yl]phthalazin-1-one |
|---|---|
| PubChem CID | 3066461 |
| Molecular Formula | C29H29ClFN3O |
| Molecular Weight | 490.02 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-2-[1-[2-(4-fluorophenyl)ethyl]azepan-4-yl]phthalazin-1-one |
| SMILES | O=c1c2ccccc2c(Cc2ccc(Cl)cc2)nn1C1CCCN(CCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C29H29ClFN3O/c30-23-11-7-22(8-12-23)20-28-26-5-1-2-6-27(26)29(35)34(32-28)25-4-3-17-33(19-16-25)18-15-21-9-13-24(31)14-10-21/h1-2,5-14,25H,3-4,15-20H2 |
| InChIKey | NPSDWIMDDLOTNT-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.02 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |