C26H25ClN4O — CID 110187816
4-[(4-chlorophenyl)methyl]-2-[1-(pyridin-4-ylmethyl)piperidin-4-yl]phthalazin-1-one (PubChem CID 110187816) has the molecular formula C26H25ClN4O and a molecular weight of 444.97 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-2-[1-(pyridin-4-ylmethyl)piperidin-4-yl]phthalazin-1-one.
| Compound Name | 4-[(4-chlorophenyl)methyl]-2-[1-(pyridin-4-ylmethyl)piperidin-4-yl]phthalazin-1-one |
|---|---|
| PubChem CID | 110187816 |
| Molecular Formula | C26H25ClN4O |
| Molecular Weight | 444.97 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-2-[1-(pyridin-4-ylmethyl)piperidin-4-yl]phthalazin-1-one |
| SMILES | O=c1c2ccccc2c(Cc2ccc(Cl)cc2)nn1C1CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C26H25ClN4O/c27-21-7-5-19(6-8-21)17-25-23-3-1-2-4-24(23)26(32)31(29-25)22-11-15-30(16-12-22)18-20-9-13-28-14-10-20/h1-10,13-14,22H,11-12,15-18H2 |
| InChIKey | KBZHFWQDUMRBJN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.97 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |