C25H32Cl2N4O — CID 67548733
2-[1-(4-aminobutyl)azepan-4-yl]-4-[(4-chlorophenyl)methyl]phthalazin-1-one;hydrochloride (PubChem CID 67548733) has the molecular formula C25H32Cl2N4O and a molecular weight of 475.46 g/mol. Its IUPAC name is 2-[1-(4-aminobutyl)azepan-4-yl]-4-[(4-chlorophenyl)methyl]phthalazin-1-one;hydrochloride.
| Compound Name | 2-[1-(4-aminobutyl)azepan-4-yl]-4-[(4-chlorophenyl)methyl]phthalazin-1-one;hydrochloride |
|---|---|
| PubChem CID | 67548733 |
| Molecular Formula | C25H32Cl2N4O |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 2-[1-(4-aminobutyl)azepan-4-yl]-4-[(4-chlorophenyl)methyl]phthalazin-1-one;hydrochloride |
| SMILES | Cl.NCCCCN1CCCC(n2nc(Cc3ccc(Cl)cc3)c3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C25H31ClN4O.ClH/c26-20-11-9-19(10-12-20)18-24-22-7-1-2-8-23(22)25(31)30(28-24)21-6-5-16-29(17-13-21)15-4-3-14-27;/h1-2,7-12,21H,3-6,13-18,27H2;1H |
| InChIKey | FNEWJSSOSAFKRW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|