C24H27ClFN3O — CID 3066443
4-[(4-fluorophenyl)methyl]-2-(1-prop-2-enylazepan-4-yl)phthalazin-1-one;hydrochloride (PubChem CID 3066443) has the molecular formula C24H27ClFN3O and a molecular weight of 427.95 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methyl]-2-(1-prop-2-enylazepan-4-yl)phthalazin-1-one;hydrochloride.
| Compound Name | 4-[(4-fluorophenyl)methyl]-2-(1-prop-2-enylazepan-4-yl)phthalazin-1-one;hydrochloride |
|---|---|
| PubChem CID | 3066443 |
| Molecular Formula | C24H27ClFN3O |
| Molecular Weight | 427.95 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 4-[(4-fluorophenyl)methyl]-2-(1-prop-2-enylazepan-4-yl)phthalazin-1-one;hydrochloride |
| SMILES | C=CCN1CCCC(n2nc(Cc3ccc(F)cc3)c3ccccc3c2=O)CC1.Cl |
| InChI | InChI=1S/C24H26FN3O.ClH/c1-2-14-27-15-5-6-20(13-16-27)28-24(29)22-8-4-3-7-21(22)23(26-28)17-18-9-11-19(25)12-10-18;/h2-4,7-12,20H,1,5-6,13-17H2;1H |
| InChIKey | WXOUCXBHYHOTRB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.95 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|