C23H27ClN3O+ — CID 110186147
4-[(4-chlorophenyl)methyl]-2-(1,1-dimethylazepan-1-ium-4-yl)phthalazin-1-one (PubChem CID 110186147) has the molecular formula C23H27ClN3O+ and a molecular weight of 396.94 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-2-(1,1-dimethylazepan-1-ium-4-yl)phthalazin-1-one.
| Compound Name | 4-[(4-chlorophenyl)methyl]-2-(1,1-dimethylazepan-1-ium-4-yl)phthalazin-1-one |
|---|---|
| PubChem CID | 110186147 |
| Molecular Formula | C23H27ClN3O+ |
| Molecular Weight | 396.94 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-2-(1,1-dimethylazepan-1-ium-4-yl)phthalazin-1-one |
| SMILES | C[N+]1(C)CCCC(n2nc(Cc3ccc(Cl)cc3)c3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C23H27ClN3O/c1-27(2)14-5-6-19(13-15-27)26-23(28)21-8-4-3-7-20(21)22(25-26)16-17-9-11-18(24)12-10-17/h3-4,7-12,19H,5-6,13-16H2,1-2H3/q+1 |
| InChIKey | FDLGLUIVHGJLHM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.94 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|