C23H24F3N3O — CID 110187414
2-(1-methylazepan-4-yl)-4-[[4-(trifluoromethyl)phenyl]methyl]phthalazin-1-one (PubChem CID 110187414) has the molecular formula C23H24F3N3O and a molecular weight of 415.46 g/mol. Its IUPAC name is 2-(1-methylazepan-4-yl)-4-[[4-(trifluoromethyl)phenyl]methyl]phthalazin-1-one.
| Compound Name | 2-(1-methylazepan-4-yl)-4-[[4-(trifluoromethyl)phenyl]methyl]phthalazin-1-one |
|---|---|
| PubChem CID | 110187414 |
| Molecular Formula | C23H24F3N3O |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 2-(1-methylazepan-4-yl)-4-[[4-(trifluoromethyl)phenyl]methyl]phthalazin-1-one |
| SMILES | CN1CCCC(n2nc(Cc3ccc(C(F)(F)F)cc3)c3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C23H24F3N3O/c1-28-13-4-5-18(12-14-28)29-22(30)20-7-3-2-6-19(20)21(27-29)15-16-8-10-17(11-9-16)23(24,25)26/h2-3,6-11,18H,4-5,12-15H2,1H3 |
| InChIKey | KZDZWJIFCUCBLI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |