C11H9N3O2 — CID 110188751
8-methyl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10-tetraene-7,12-dione (PubChem CID 110188751) has the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. Its IUPAC name is 8-methyl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10-tetraene-7,12-dione.
| Compound Name | 8-methyl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10-tetraene-7,12-dione |
|---|---|
| PubChem CID | 110188751 |
| Molecular Formula | C11H9N3O2 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 8-methyl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10-tetraene-7,12-dione |
| SMILES | Cn1c(=O)c2cccn2c2[nH]c(=O)ccc21 |
| InChI | InChI=1S/C11H9N3O2/c1-13-7-4-5-9(15)12-10(7)14-6-2-3-8(14)11(13)16/h2-6H,1H3,(H,12,15) |
| InChIKey | IVAKKAAQDQXUFW-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 59.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |