(3R)-3-methylhept-6-enoic acid

C8H14O2 — CID 11018976

IUPAC(3R)-3-methylhept-6-enoic acid
SMILESC=CCC[C@@H](C)CC(=O)O
InChIInChI=1S/C8H14O2/c1-3-4-5-7(2)6-8(9)10/h3,7H,1,4-6H2,2H3,(H,9,10)/t7-/m1/s1
InChIKeyPDTSTRJTHMDMHE-SSDOTTSWSA-N
MW142.20 g/mol
LogP2.06
Rot. Bonds5

About (3R)-3-methylhept-6-enoic acid

(3R)-3-methylhept-6-enoic acid (PubChem CID 11018976) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is (3R)-3-methylhept-6-enoic acid.

Molecular Properties

Compound Name(3R)-3-methylhept-6-enoic acid
PubChem CID11018976
Molecular FormulaC8H14O2
Molecular Weight142.20 g/mol
Exact Mass142.10
IUPAC Name(3R)-3-methylhept-6-enoic acid
SMILESC=CCC[C@@H](C)CC(=O)O
InChIInChI=1S/C8H14O2/c1-3-4-5-7(2)6-8(9)10/h3,7H,1,4-6H2,2H3,(H,9,10)/t7-/m1/s1
InChIKeyPDTSTRJTHMDMHE-SSDOTTSWSA-N
XLogP2.06
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.20
LogP ≤ 52.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (3R)-3-methylhept-6-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Citronellic acid
CID 10402
(+-)-2-n-Propyl-4-pentenoic acid
CID 104896
(6E)-8-Methyl-6-nonenoic acid
CID 5365959
6-Methylcyclohex-3-ene-1-carboxylic acid
CID 221278
(R)-(+)-citronellic acid
CID 6999957
2-Cyclopentene-1-acetic acid
CID 96216
(4Z)-cyclooct-4-ene-1-carboxylic acid
CID 5382865
(S)-(-)-Citronellic acid
CID 6999955
2-Methylcyclohex-3-ene-1-carboxylic acid
CID 199676
2-(2-Methylpropyl)pent-4-enoic acid
CID 13010743
4-Methyl-3-cyclohexene-1-carboxylic Acid
CID 20350
(6Z)-8-methylnon-6-enoic acid
CID 5709062

Frequently Asked Questions

What is the IUPAC name of (3R)-3-methylhept-6-enoic acid?
The IUPAC name of (3R)-3-methylhept-6-enoic acid (CID 11018976) is (3R)-3-methylhept-6-enoic acid.
What is the SMILES notation for (3R)-3-methylhept-6-enoic acid?
The canonical SMILES for (3R)-3-methylhept-6-enoic acid is C=CCC[C@@H](C)CC(=O)O.
What is the InChIKey of (3R)-3-methylhept-6-enoic acid?
The InChIKey is PDTSTRJTHMDMHE-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H14O2/c1-3-4-5-7(2)6-8(9)10/h3,7H,1,4-6H2,2H3,(H,9,10)/t7-/m1/s1.
What are the key properties of (3R)-3-methylhept-6-enoic acid?
(3R)-3-methylhept-6-enoic acid has a molecular weight of 142.20 g/mol, XLogP of 2.06, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-methylhept-6-enoic acid is sourced from PubChem (CID 11018976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).