C15H15ClO2S — CID 110191565
S-(4,4-dimethyl-6-oxocyclohexen-1-yl) 2-chlorobenzenecarbothioate (PubChem CID 110191565) has the molecular formula C15H15ClO2S and a molecular weight of 294.80 g/mol. Its IUPAC name is S-(4,4-dimethyl-6-oxocyclohexen-1-yl) 2-chlorobenzenecarbothioate.
| Compound Name | S-(4,4-dimethyl-6-oxocyclohexen-1-yl) 2-chlorobenzenecarbothioate |
|---|---|
| PubChem CID | 110191565 |
| Molecular Formula | C15H15ClO2S |
| Molecular Weight | 294.80 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | S-(4,4-dimethyl-6-oxocyclohexen-1-yl) 2-chlorobenzenecarbothioate |
| SMILES | CC1(C)CC=C(SC(=O)c2ccccc2Cl)C(=O)C1 |
| InChI | InChI=1S/C15H15ClO2S/c1-15(2)8-7-13(12(17)9-15)19-14(18)10-5-3-4-6-11(10)16/h3-7H,8-9H2,1-2H3 |
| InChIKey | GTRZZSJNTMEGAM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.80 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|