About S-(4,4-dimethyl-6-oxocyclohexen-1-yl) 2-chlorobenzenecarbothioate
S-(4,4-dimethyl-6-oxocyclohexen-1-yl) 2-chlorobenzenecarbothioate (PubChem CID 110191565) has the molecular formula C15H15ClO2S
and a molecular weight of 294.80 g/mol. Its IUPAC name is S-(4,4-dimethyl-6-oxocyclohexen-1-yl) 2-chlorobenzenecarbothioate.
Molecular Properties
| Compound Name | S-(4,4-dimethyl-6-oxocyclohexen-1-yl) 2-chlorobenzenecarbothioate |
| PubChem CID | 110191565 |
| Molecular Formula | C15H15ClO2S |
| Molecular Weight | 294.80 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | S-(4,4-dimethyl-6-oxocyclohexen-1-yl) 2-chlorobenzenecarbothioate |
| SMILES | CC1(C)CC=C(SC(=O)c2ccccc2Cl)C(=O)C1 |
| InChI | InChI=1S/C15H15ClO2S/c1-15(2)8-7-13(12(17)9-15)19-14(18)10-5-3-4-6-11(10)16/h3-7H,8-9H2,1-2H3 |
| InChIKey | GTRZZSJNTMEGAM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.80 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4,4-dimethyl-6-oxocyclohexen-1-yl) 2-chlorobenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4,4-dimethyl-6-oxocyclohexen-1-yl) 2-chlorobenzenecarbothioate?
The IUPAC name of S-(4,4-dimethyl-6-oxocyclohexen-1-yl) 2-chlorobenzenecarbothioate (CID 110191565) is S-(4,4-dimethyl-6-oxocyclohexen-1-yl) 2-chlorobenzenecarbothioate.
What is the SMILES notation for S-(4,4-dimethyl-6-oxocyclohexen-1-yl) 2-chlorobenzenecarbothioate?
The canonical SMILES for S-(4,4-dimethyl-6-oxocyclohexen-1-yl) 2-chlorobenzenecarbothioate is CC1(C)CC=C(SC(=O)c2ccccc2Cl)C(=O)C1.
What is the InChIKey of S-(4,4-dimethyl-6-oxocyclohexen-1-yl) 2-chlorobenzenecarbothioate?
The InChIKey is GTRZZSJNTMEGAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClO2S/c1-15(2)8-7-13(12(17)9-15)19-14(18)10-5-3-4-6-11(10)16/h3-7H,8-9H2,1-2H3.
What are the key properties of S-(4,4-dimethyl-6-oxocyclohexen-1-yl) 2-chlorobenzenecarbothioate?
S-(4,4-dimethyl-6-oxocyclohexen-1-yl) 2-chlorobenzenecarbothioate has a molecular weight of 294.80 g/mol, XLogP of 4.49, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4,4-dimethyl-6-oxocyclohexen-1-yl) 2-chlorobenzenecarbothioate is sourced from PubChem (CID 110191565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).