C13H13ClN2O3 — CID 110192020
(7aS)-6-(4-chlorophenyl)-3,3-dimethyl-1,7a-dihydroimidazo[1,5-c][1,3]oxazole-5,7-dione (PubChem CID 110192020) has the molecular formula C13H13ClN2O3 and a molecular weight of 280.71 g/mol. Its IUPAC name is (7aS)-6-(4-chlorophenyl)-3,3-dimethyl-1,7a-dihydroimidazo[1,5-c][1,3]oxazole-5,7-dione.
| Compound Name | (7aS)-6-(4-chlorophenyl)-3,3-dimethyl-1,7a-dihydroimidazo[1,5-c][1,3]oxazole-5,7-dione |
|---|---|
| PubChem CID | 110192020 |
| Molecular Formula | C13H13ClN2O3 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | (7aS)-6-(4-chlorophenyl)-3,3-dimethyl-1,7a-dihydroimidazo[1,5-c][1,3]oxazole-5,7-dione |
| SMILES | CC1(C)OC[C@H]2C(=O)N(c3ccc(Cl)cc3)C(=O)N21 |
| InChI | InChI=1S/C13H13ClN2O3/c1-13(2)16-10(7-19-13)11(17)15(12(16)18)9-5-3-8(14)4-6-9/h3-6,10H,7H2,1-2H3/t10-/m0/s1 |
| InChIKey | XZBXXNLGERJXFE-JTQLQIEISA-N |
| XLogP | 2.24 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|