About phenacylsulfanyl N-butylcarbamodithioate
phenacylsulfanyl N-butylcarbamodithioate (PubChem CID 110192273) has the molecular formula C13H17NOS3
and a molecular weight of 299.49 g/mol. Its IUPAC name is phenacylsulfanyl N-butylcarbamodithioate.
Molecular Properties
| Compound Name | phenacylsulfanyl N-butylcarbamodithioate |
| PubChem CID | 110192273 |
| Molecular Formula | C13H17NOS3 |
| Molecular Weight | 299.49 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | phenacylsulfanyl N-butylcarbamodithioate |
| SMILES | CCCCNC(=S)SSCC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H17NOS3/c1-2-3-9-14-13(16)18-17-10-12(15)11-7-5-4-6-8-11/h4-8H,2-3,9-10H2,1H3,(H,14,16) |
| InChIKey | NGGRVBJOPNQSKQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze phenacylsulfanyl N-butylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenacylsulfanyl N-butylcarbamodithioate?
The IUPAC name of phenacylsulfanyl N-butylcarbamodithioate (CID 110192273) is phenacylsulfanyl N-butylcarbamodithioate.
What is the SMILES notation for phenacylsulfanyl N-butylcarbamodithioate?
The canonical SMILES for phenacylsulfanyl N-butylcarbamodithioate is CCCCNC(=S)SSCC(=O)c1ccccc1.
What is the InChIKey of phenacylsulfanyl N-butylcarbamodithioate?
The InChIKey is NGGRVBJOPNQSKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NOS3/c1-2-3-9-14-13(16)18-17-10-12(15)11-7-5-4-6-8-11/h4-8H,2-3,9-10H2,1H3,(H,14,16).
What are the key properties of phenacylsulfanyl N-butylcarbamodithioate?
phenacylsulfanyl N-butylcarbamodithioate has a molecular weight of 299.49 g/mol, XLogP of 3.93, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenacylsulfanyl N-butylcarbamodithioate is sourced from PubChem (CID 110192273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).