About phenacylsulfanyl N-propan-2-ylcarbamodithioate
phenacylsulfanyl N-propan-2-ylcarbamodithioate (PubChem CID 110189952) has the molecular formula C12H15NOS3
and a molecular weight of 285.46 g/mol. Its IUPAC name is phenacylsulfanyl N-propan-2-ylcarbamodithioate.
Molecular Properties
| Compound Name | phenacylsulfanyl N-propan-2-ylcarbamodithioate |
| PubChem CID | 110189952 |
| Molecular Formula | C12H15NOS3 |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | phenacylsulfanyl N-propan-2-ylcarbamodithioate |
| SMILES | CC(C)NC(=S)SSCC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H15NOS3/c1-9(2)13-12(15)17-16-8-11(14)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3,(H,13,15) |
| InChIKey | SUDLHLRSDPSASC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze phenacylsulfanyl N-propan-2-ylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenacylsulfanyl N-propan-2-ylcarbamodithioate?
The IUPAC name of phenacylsulfanyl N-propan-2-ylcarbamodithioate (CID 110189952) is phenacylsulfanyl N-propan-2-ylcarbamodithioate.
What is the SMILES notation for phenacylsulfanyl N-propan-2-ylcarbamodithioate?
The canonical SMILES for phenacylsulfanyl N-propan-2-ylcarbamodithioate is CC(C)NC(=S)SSCC(=O)c1ccccc1.
What is the InChIKey of phenacylsulfanyl N-propan-2-ylcarbamodithioate?
The InChIKey is SUDLHLRSDPSASC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NOS3/c1-9(2)13-12(15)17-16-8-11(14)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3,(H,13,15).
What are the key properties of phenacylsulfanyl N-propan-2-ylcarbamodithioate?
phenacylsulfanyl N-propan-2-ylcarbamodithioate has a molecular weight of 285.46 g/mol, XLogP of 3.53, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenacylsulfanyl N-propan-2-ylcarbamodithioate is sourced from PubChem (CID 110189952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).