C22H26N4O4 — CID 110194215
1-[(E)-(4-acetamidophenyl)methylideneamino]-N-(3,4-dimethoxyphenyl)pyrrolidine-2-carboxamide (PubChem CID 110194215) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 1-[(E)-(4-acetamidophenyl)methylideneamino]-N-(3,4-dimethoxyphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[(E)-(4-acetamidophenyl)methylideneamino]-N-(3,4-dimethoxyphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110194215 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 1-[(E)-(4-acetamidophenyl)methylideneamino]-N-(3,4-dimethoxyphenyl)pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCCN2/N=C/c2ccc(NC(C)=O)cc2)cc1OC |
| InChI | InChI=1S/C22H26N4O4/c1-15(27)24-17-8-6-16(7-9-17)14-23-26-12-4-5-19(26)22(28)25-18-10-11-20(29-2)21(13-18)30-3/h6-11,13-14,19H,4-5,12H2,1-3H3,(H,24,27)(H,25,28)/b23-14+ |
| InChIKey | WHDJEXJDLOMAHK-OEAKJJBVSA-N |
| XLogP | 3.10 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|