C25H32N4O4 — CID 110194180
N-(2-carbamoylphenyl)-1-[(E)-[4-methoxy-3-(2-methylpropoxy)phenyl]methylideneamino]piperidine-2-carboxamide (PubChem CID 110194180) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is N-(2-carbamoylphenyl)-1-[(E)-[4-methoxy-3-(2-methylpropoxy)phenyl]methylideneamino]piperidine-2-carboxamide.
| Compound Name | N-(2-carbamoylphenyl)-1-[(E)-[4-methoxy-3-(2-methylpropoxy)phenyl]methylideneamino]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 110194180 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | N-(2-carbamoylphenyl)-1-[(E)-[4-methoxy-3-(2-methylpropoxy)phenyl]methylideneamino]piperidine-2-carboxamide |
| SMILES | COc1ccc(/C=N/N2CCCCC2C(=O)Nc2ccccc2C(N)=O)cc1OCC(C)C |
| InChI | InChI=1S/C25H32N4O4/c1-17(2)16-33-23-14-18(11-12-22(23)32-3)15-27-29-13-7-6-10-21(29)25(31)28-20-9-5-4-8-19(20)24(26)30/h4-5,8-9,11-12,14-15,17,21H,6-7,10,13,16H2,1-3H3,(H2,26,30)(H,28,31)/b27-15+ |
| InChIKey | LRBQAONCXHEPQW-JFLMPSFJSA-N |
| XLogP | 3.66 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|