C26H33N3O6 — CID 91465128
methyl 4-[[2-[[4-methoxy-3-(2-methylpropoxy)phenyl]carbamoyloxy]piperidin-1-yl]iminomethyl]benzoate (PubChem CID 91465128) has the molecular formula C26H33N3O6 and a molecular weight of 483.57 g/mol. Its IUPAC name is methyl 4-[[2-[[4-methoxy-3-(2-methylpropoxy)phenyl]carbamoyloxy]piperidin-1-yl]iminomethyl]benzoate.
| Compound Name | methyl 4-[[2-[[4-methoxy-3-(2-methylpropoxy)phenyl]carbamoyloxy]piperidin-1-yl]iminomethyl]benzoate |
|---|---|
| PubChem CID | 91465128 |
| Molecular Formula | C26H33N3O6 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | methyl 4-[[2-[[4-methoxy-3-(2-methylpropoxy)phenyl]carbamoyloxy]piperidin-1-yl]iminomethyl]benzoate |
| SMILES | COC(=O)c1ccc(C=NN2CCCCC2OC(=O)Nc2ccc(OC)c(OCC(C)C)c2)cc1 |
| InChI | InChI=1S/C26H33N3O6/c1-18(2)17-34-23-15-21(12-13-22(23)32-3)28-26(31)35-24-7-5-6-14-29(24)27-16-19-8-10-20(11-9-19)25(30)33-4/h8-13,15-16,18,24H,5-7,14,17H2,1-4H3,(H,28,31) |
| InChIKey | BIODLPWGGDDWQQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|