C19H18N3O2+ — CID 110194367
N-[5-(1-benzylpyridin-1-ium-4-yl)-2-oxo-1H-pyridin-3-yl]acetamide (PubChem CID 110194367) has the molecular formula C19H18N3O2+ and a molecular weight of 320.37 g/mol. Its IUPAC name is N-[5-(1-benzylpyridin-1-ium-4-yl)-2-oxo-1H-pyridin-3-yl]acetamide.
| Compound Name | N-[5-(1-benzylpyridin-1-ium-4-yl)-2-oxo-1H-pyridin-3-yl]acetamide |
|---|---|
| PubChem CID | 110194367 |
| Molecular Formula | C19H18N3O2+ |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-[5-(1-benzylpyridin-1-ium-4-yl)-2-oxo-1H-pyridin-3-yl]acetamide |
| SMILES | CC(=O)Nc1cc(-c2cc[n+](Cc3ccccc3)cc2)c[nH]c1=O |
| InChI | InChI=1S/C19H17N3O2/c1-14(23)21-18-11-17(12-20-19(18)24)16-7-9-22(10-8-16)13-15-5-3-2-4-6-15/h2-12H,13H2,1H3,(H,21,23)/p+1 |
| InChIKey | CGIIJLAHSDXYSJ-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|