C31H44N4O — CID 110195327
4-[(1S,2R,5S)-7-benzyl-3,7-diazabicyclo[3.3.1]nonan-2-yl]-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]butanamide (PubChem CID 110195327) has the molecular formula C31H44N4O and a molecular weight of 488.72 g/mol. Its IUPAC name is 4-[(1S,2R,5S)-7-benzyl-3,7-diazabicyclo[3.3.1]nonan-2-yl]-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]butanamide.
| Compound Name | 4-[(1S,2R,5S)-7-benzyl-3,7-diazabicyclo[3.3.1]nonan-2-yl]-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 110195327 |
| Molecular Formula | C31H44N4O |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | 4-[(1S,2R,5S)-7-benzyl-3,7-diazabicyclo[3.3.1]nonan-2-yl]-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]butanamide |
| SMILES | CN(Cc1ccc(N2CCCCC2)cc1)C(=O)CCC[C@H]1NC[C@@H]2C[C@H]1CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C31H44N4O/c1-33(21-26-13-15-29(16-14-26)35-17-6-3-7-18-35)31(36)12-8-11-30-28-19-27(20-32-30)23-34(24-28)22-25-9-4-2-5-10-25/h2,4-5,9-10,13-16,27-28,30,32H,3,6-8,11-12,17-24H2,1H3/t27-,28-,30+/m0/s1 |
| InChIKey | PVAGETHTFSVSKS-TWLDFKIOSA-N |
| XLogP | 4.92 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|