C30H44Cl2N4O2 — CID 163339798
4-[(1S,2R,5S)-7-benzyl-3,7-diazabicyclo[3.3.1]nonan-2-yl]-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]butanamide;dihydrochloride (PubChem CID 163339798) has the molecular formula C30H44Cl2N4O2 and a molecular weight of 563.61 g/mol. Its IUPAC name is 4-[(1S,2R,5S)-7-benzyl-3,7-diazabicyclo[3.3.1]nonan-2-yl]-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]butanamide;dihydrochloride.
| Compound Name | 4-[(1S,2R,5S)-7-benzyl-3,7-diazabicyclo[3.3.1]nonan-2-yl]-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 163339798 |
| Molecular Formula | C30H44Cl2N4O2 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | 4-[(1S,2R,5S)-7-benzyl-3,7-diazabicyclo[3.3.1]nonan-2-yl]-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]butanamide;dihydrochloride |
| SMILES | CN(Cc1ccc(N2CCOCC2)cc1)C(=O)CCC[C@H]1NC[C@@H]2C[C@H]1CN(Cc1ccccc1)C2.Cl.Cl |
| InChI | InChI=1S/C30H42N4O2.2ClH/c1-32(20-25-10-12-28(13-11-25)34-14-16-36-17-15-34)30(35)9-5-8-29-27-18-26(19-31-29)22-33(23-27)21-24-6-3-2-4-7-24;;/h2-4,6-7,10-13,26-27,29,31H,5,8-9,14-23H2,1H3;2*1H/t26-,27-,29+;;/m0../s1 |
| InChIKey | AOCWSZAYLJSFJG-JQWMBOHNSA-N |
| XLogP | 4.61 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|