C28H41N3O2 — CID 110195917
4-[(5R,6R,9S,13S)-7-benzoyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-1-(4-methylpiperidin-1-yl)butan-1-one (PubChem CID 110195917) has the molecular formula C28H41N3O2 and a molecular weight of 451.66 g/mol. Its IUPAC name is 4-[(5R,6R,9S,13S)-7-benzoyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-1-(4-methylpiperidin-1-yl)butan-1-one.
| Compound Name | 4-[(5R,6R,9S,13S)-7-benzoyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-1-(4-methylpiperidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 110195917 |
| Molecular Formula | C28H41N3O2 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.32 |
| IUPAC Name | 4-[(5R,6R,9S,13S)-7-benzoyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-1-(4-methylpiperidin-1-yl)butan-1-one |
| SMILES | CC1CCN(C(=O)CCC[C@@H]2[C@H]3CCCN4CCC[C@@H](CN2C(=O)c2ccccc2)[C@@H]34)CC1 |
| InChI | InChI=1S/C28H41N3O2/c1-21-14-18-29(19-15-21)26(32)13-5-12-25-24-11-7-17-30-16-6-10-23(27(24)30)20-31(25)28(33)22-8-3-2-4-9-22/h2-4,8-9,21,23-25,27H,5-7,10-20H2,1H3/t23-,24+,25+,27-/m0/s1 |
| InChIKey | QAPLEWOADWEJDN-FCRYVSRXSA-N |
| XLogP | 4.43 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |