C26H33N3O3 — CID 110875395
4-[(5R,6R,9S,13S)-7-(furan-2-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-phenylbutanamide (PubChem CID 110875395) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 4-[(5R,6R,9S,13S)-7-(furan-2-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-phenylbutanamide.
| Compound Name | 4-[(5R,6R,9S,13S)-7-(furan-2-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-phenylbutanamide |
|---|---|
| PubChem CID | 110875395 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 4-[(5R,6R,9S,13S)-7-(furan-2-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-phenylbutanamide |
| SMILES | O=C(CCC[C@@H]1[C@H]2CCCN3CCC[C@@H](CN1C(=O)c1ccco1)[C@@H]23)Nc1ccccc1 |
| InChI | InChI=1S/C26H33N3O3/c30-24(27-20-9-2-1-3-10-20)14-4-12-22-21-11-6-16-28-15-5-8-19(25(21)28)18-29(22)26(31)23-13-7-17-32-23/h1-3,7,9-10,13,17,19,21-22,25H,4-6,8,11-12,14-16,18H2,(H,27,30)/t19-,21+,22+,25-/m0/s1 |
| InChIKey | WOULMOBSHCSPDF-XSARVHFWSA-N |
| XLogP | 4.40 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |