C33H47N5O — CID 110875488
N-(1-benzylpiperidin-4-yl)-4-[(5R,6R,9S,13S)-7-(pyridin-3-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide (PubChem CID 110875488) has the molecular formula C33H47N5O and a molecular weight of 529.77 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-4-[(5R,6R,9S,13S)-7-(pyridin-3-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-4-[(5R,6R,9S,13S)-7-(pyridin-3-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
|---|---|
| PubChem CID | 110875488 |
| Molecular Formula | C33H47N5O |
| Molecular Weight | 529.77 g/mol |
| Exact Mass | 529.38 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-4-[(5R,6R,9S,13S)-7-(pyridin-3-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
| SMILES | O=C(CCC[C@@H]1[C@H]2CCCN3CCC[C@@H](CN1Cc1cccnc1)[C@@H]23)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C33H47N5O/c39-32(35-29-15-20-36(21-16-29)23-26-8-2-1-3-9-26)14-4-13-31-30-12-7-19-37-18-6-11-28(33(30)37)25-38(31)24-27-10-5-17-34-22-27/h1-3,5,8-10,17,22,28-31,33H,4,6-7,11-16,18-21,23-25H2,(H,35,39)/t28-,30+,31+,33-/m0/s1 |
| InChIKey | MATOWGQKOULHBG-VVHQHVLRSA-N |
| XLogP | 4.71 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.77 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |